Protein Modification Reagents
![eMolecules (S, R, S)-AHPC-PEG8-NHS ester | Broadpharm |980.140 | C46H69N5O16S | 98.000 | Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O)C(C)(C)C)cc1 | 250mg | 573896592](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502183626.JPG-250.jpg)
eMolecules (S, R, S)-AHPC-PEG8-NHS ester | Broadpharm |980.140 | C46H69N5O16S | 98.000 | Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O)C(C)(C)C)cc1 | 250mg | 573896592
(S, R, S)-AHPC-PEG8-NHS ester | Broadpharm |980.140 | C46H69N5O16S | 98.000 | Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O)C(C)(C)C)cc1 | 250mg | 573896592
eMolecules 2204246-03-5 | Pomalidomide-PEG3-NH-Boc | Broadpharm548.593 | C26H36N4O9 | 0.000 | CC(C)(C)OC(=O)NCCOCCOCCOCCNc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12 | 500mg | 533795541
Pomalidomide-PEG3-NH-Boc | Broadpharm | 2204246-03-5548.593 | C26H36N4O9 | 0.000 | CC(C)(C)OC(=O)NCCOCCOCCOCCNc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12 | 500mg | 533795541
![eMolecules 2354291-37-3 | Gly-PEG3-endo-BCN | Broadpharm453.580 | C23H39N3O6 | 0.000 | NCC(=O)NCCCOCCOCCOCCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 100mg | 550804569](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502183536.JPG-250.jpg)
eMolecules 2354291-37-3 | Gly-PEG3-endo-BCN | Broadpharm453.580 | C23H39N3O6 | 0.000 | NCC(=O)NCCCOCCOCCOCCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 100mg | 550804569
Gly-PEG3-endo-BCN | Broadpharm | 2354291-37-3453.580 | C23H39N3O6 | 0.000 | NCC(=O)NCCCOCCOCCOCCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 100mg | 550804569
eMolecules 17-(Bromoacetamido-PEG9-ethylcarbamoyl)pentanoic t-butyl ester | Broadpharm |761.745 | C32H61BrN2O13 | 98.000 | CC(C)(C)OC(=O)CCCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CBr | 250mg | 490840961
17-(Bromoacetamido-PEG9-ethylcarbamoyl)pentanoic t-butyl ester | Broadpharm |761.745 | C32H61BrN2O13 | 98.000 | CC(C)(C)OC(=O)CCCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CBr | 250mg | 490840961
eMolecules 1191064-81-9 | FMOC-NH-PEG9-CH2CH2COOH | MFCD28385470 | 1g
1-(5-Bromo-6-methoxy-pyridin-3-yl)-ethanone | Chemcia | 1256837-15-6 | MFCD18258545 | 230.061 | C8H8BrNO2 | 97.000 | COc1ncc(cc1Br)C(C)=O | 1g | 322910615
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 17-(Amino-PEG6-ethylcarbamoyl)heptadecanoic acid, TFA salt | Broadpharm |620.869 | C32H64N2O9 | 0.000 | NCCOCCOCCOCCOCCOCCOCCNC(=O)CCCCCCCCCCCCCCCCC(O)=O | 500mg | 550804614
17-(Amino-PEG6-ethylcarbamoyl)heptadecanoic acid, TFA salt | Broadpharm |620.869 | C32H64N2O9 | 0.000 | NCCOCCOCCOCCOCCOCCOCCNC(=O)CCCCCCCCCCCCCCCCC(O)=O | 500mg | 550804614
Worthington Biochemical Corporation Collagenase CLSAFA Animal Free, 5 g
CLSAFA is the original AFA grade designed to have collagenase and secondary proteases similar to Types 1 and 2 collagenase. ≥150 units per mg dry weight.
Broadpharm DSPE-PEG-Mannose, MW 5000, Unit Size 100 mg
DSPE-PEG-Mannose is a high-purity polyethylene glycol (PEG) polymer engineered for advanced scientific applications. This amphiphilic conjugate consists of a hydrophobic DSPE moiety and a hydrophilic mannose-terminated PEG chain, which facilitates the encapsulation of hydrophobic drugs while enhancing water solubility for efficient drug delivery. Its broad utility spans medical research, drug release studies, nanotechnology, and the development of targeted drug carriers such as liposomes. This versatile compound significantly improves the selectivity of PEGylation reactions and supports various applications including peptide synthesis and the creation of functional coatings.
- Molecular weight of 5000
- Unit size of 100 mg
- Hydrophobic DSPE and hydrophilic PEG components
- Increases selectivity of PEGylation reactions
- Improved solubility due to D-glucose
- Utilized in drug delivery systems and mRNA vaccines